C38H25N5O4S — CID 135936904
11-(4-methylphenyl)-6,16-bis(4-nitrophenyl)-21-thia-20,22,23-triazapentacyclo[15.2.1.12,5.17,10.112,15]tricosa-1,3,5(23),6,8,10,12,14,16,18-decaene (PubChem CID 135936904) has the molecular formula C38H25N5O4S and a molecular weight of 647.72 g/mol. Its IUPAC name is 11-(4-methylphenyl)-6,16-bis(4-nitrophenyl)-21-thia-20,22,23-triazapentacyclo[15.2.1.12,5.17,10.112,15]tricosa-1,3,5(23),6,8,10,12,14,16,18-decaene.
| Compound Name | 11-(4-methylphenyl)-6,16-bis(4-nitrophenyl)-21-thia-20,22,23-triazapentacyclo[15.2.1.12,5.17,10.112,15]tricosa-1,3,5(23),6,8,10,12,14,16,18-decaene |
|---|---|
| PubChem CID | 135936904 |
| Molecular Formula | C38H25N5O4S |
| Molecular Weight | 647.72 g/mol |
| Exact Mass | 647.16 |
| IUPAC Name | 11-(4-methylphenyl)-6,16-bis(4-nitrophenyl)-21-thia-20,22,23-triazapentacyclo[15.2.1.12,5.17,10.112,15]tricosa-1,3,5(23),6,8,10,12,14,16,18-decaene |
| SMILES | Cc1ccc(-c2c3ccc([nH]3)c(-c3ccc([N+](=O)[O-])cc3)c3nc(c4ccc([nH]4)c(-c4ccc([N+](=O)[O-])cc4)c4ccc2s4)C=C3)cc1 |
| InChI | InChI=1S/C38H25N5O4S/c1-22-2-4-24(5-3-22)37-33-19-18-31(41-33)36(23-6-10-26(11-7-23)42(44)45)30-16-14-28(39-30)29-15-17-32(40-29)38(35-21-20-34(37)48-35)25-8-12-27(13-9-25)43(46)47/h2-21,40-41H,1H3/b29-28-,36-30-,36-31-,37-33-,37-34-,38-32-,38-35- |
| InChIKey | HWFKAGZGFBUWPY-SBPFEAJJSA-N |
| XLogP | 10.56 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.72 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|