C40H31N5O2 — CID 136862430
5,10,15-tris(4-methylphenyl)-3-nitro-22,23-dihydro-21H-corrin (PubChem CID 136862430) has the molecular formula C40H31N5O2 and a molecular weight of 613.72 g/mol. Its IUPAC name is 5,10,15-tris(4-methylphenyl)-3-nitro-22,23-dihydro-21H-corrin.
| Compound Name | 5,10,15-tris(4-methylphenyl)-3-nitro-22,23-dihydro-21H-corrin |
|---|---|
| PubChem CID | 136862430 |
| Molecular Formula | C40H31N5O2 |
| Molecular Weight | 613.72 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | 5,10,15-tris(4-methylphenyl)-3-nitro-22,23-dihydro-21H-corrin |
| SMILES | Cc1ccc(-c2c3nc(c4cc([N+](=O)[O-])c([nH]4)c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4ccc(C)cc4)c4ccc2[nH]4)C=C3)cc1 |
| InChI | InChI=1S/C40H31N5O2/c1-23-4-10-26(11-5-23)37-30-17-16-29(41-30)35-22-36(45(46)47)40(44-35)39(28-14-8-25(3)9-15-28)34-21-20-33(43-34)38(32-19-18-31(37)42-32)27-12-6-24(2)7-13-27/h4-22,42-44H,1-3H3/b35-29-,37-30-,37-31-,38-32-,38-33-,39-34-,40-39- |
| InChIKey | SOLWMVRCFNSKEQ-RIKWOJAGSA-N |
| XLogP | 10.53 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.72 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|