C68H76IN5O2 — CID 10653893
5,15,20-tris(3,5-ditert-butylphenyl)-10-(4-iodophenyl)-2-nitro-21,22-dihydroporphyrin (PubChem CID 10653893) has the molecular formula C68H76IN5O2 and a molecular weight of 1122.29 g/mol. Its IUPAC name is 5,15,20-tris(3,5-ditert-butylphenyl)-10-(4-iodophenyl)-2-nitro-21,22-dihydroporphyrin.
| Compound Name | 5,15,20-tris(3,5-ditert-butylphenyl)-10-(4-iodophenyl)-2-nitro-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10653893 |
| Molecular Formula | C68H76IN5O2 |
| Molecular Weight | 1122.29 g/mol |
| Exact Mass | 1121.50 |
| IUPAC Name | 5,15,20-tris(3,5-ditert-butylphenyl)-10-(4-iodophenyl)-2-nitro-21,22-dihydroporphyrin |
| SMILES | CC(C)(C)c1cc(-c2c3nc(c(-c4ccc(I)cc4)c4ccc([nH]4)c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4cc([N+](=O)[O-])c([nH]4)c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4nc2C=C4)C=C3)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C68H76IN5O2/c1-63(2,3)43-29-40(30-44(35-43)64(4,5)6)59-52-25-23-50(70-52)58(39-19-21-49(69)22-20-39)51-24-26-54(71-51)60(41-31-45(65(7,8)9)36-46(32-41)66(10,11)12)56-38-57(74(75)76)62(73-56)61(55-28-27-53(59)72-55)42-33-47(67(13,14)15)37-48(34-42)68(16,17)18/h19-38,71,73H,1-18H3/b58-50-,58-51-,59-52-,59-53-,60-54-,60-56-,61-55-,62-61- |
| InChIKey | CSJDDSUCJOVDLH-DKRHCLBTSA-N |
| XLogP | 19.62 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1122.29 |
| LogP ≤ 5 | 19.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|