C52H44I2N4 — CID 136913893
5,20-bis(4-tert-butylphenyl)-10,15-bis(4-iodophenyl)-21,23-dihydroporphyrin (PubChem CID 136913893) has the molecular formula C52H44I2N4 and a molecular weight of 978.76 g/mol. Its IUPAC name is 5,20-bis(4-tert-butylphenyl)-10,15-bis(4-iodophenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,20-bis(4-tert-butylphenyl)-10,15-bis(4-iodophenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136913893 |
| Molecular Formula | C52H44I2N4 |
| Molecular Weight | 978.76 g/mol |
| Exact Mass | 978.17 |
| IUPAC Name | 5,20-bis(4-tert-butylphenyl)-10,15-bis(4-iodophenyl)-21,23-dihydroporphyrin |
| SMILES | CC(C)(C)c1ccc(-c2c3nc(c(-c4ccc(I)cc4)c4ccc([nH]4)c(-c4ccc(I)cc4)c4nc(c(-c5ccc(C(C)(C)C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C52H44I2N4/c1-51(2,3)35-15-7-31(8-16-35)47-39-23-24-40(55-39)48(32-9-17-36(18-10-32)52(4,5)6)42-26-28-44(57-42)50(34-13-21-38(54)22-14-34)46-30-29-45(58-46)49(43-27-25-41(47)56-43)33-11-19-37(53)20-12-33/h7-30,55,58H,1-6H3/b47-39-,47-41-,48-40-,48-42-,49-43-,49-45-,50-44-,50-46- |
| InChIKey | NXMJLSFXWYVQFO-ODBMIYHYSA-N |
| XLogP | 15.13 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 978.76 |
| LogP ≤ 5 | 15.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|