C60H63N5 — CID 177400396
5,10,15,20-tetrakis(4-tert-butylphenyl)-22,24-dihydroporphyrin-2-amine (PubChem CID 177400396) has the molecular formula C60H63N5 and a molecular weight of 854.20 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(4-tert-butylphenyl)-22,24-dihydroporphyrin-2-amine.
| Compound Name | 5,10,15,20-tetrakis(4-tert-butylphenyl)-22,24-dihydroporphyrin-2-amine |
|---|---|
| PubChem CID | 177400396 |
| Molecular Formula | C60H63N5 |
| Molecular Weight | 854.20 g/mol |
| Exact Mass | 853.51 |
| IUPAC Name | 5,10,15,20-tetrakis(4-tert-butylphenyl)-22,24-dihydroporphyrin-2-amine |
| SMILES | CC(C)(C)c1ccc(-c2c3nc(c(-c4ccc(C(C)(C)C)cc4)c4ccc([nH]4)c(-c4ccc(C(C)(C)C)cc4)c4nc(c(-c5ccc(C(C)(C)C)cc5)c5ccc2[nH]5)C=C4N)C=C3)cc1 |
| InChI | InChI=1S/C60H63N5/c1-57(2,3)40-21-13-36(14-22-40)52-45-29-30-46(62-45)53(37-15-23-41(24-16-37)58(4,5)6)48-33-34-50(64-48)55(39-19-27-43(28-20-39)60(10,11)12)56-44(61)35-51(65-56)54(49-32-31-47(52)63-49)38-17-25-42(26-18-38)59(7,8)9/h13-35,63-64H,61H2,1-12H3/b52-45-,52-47-,53-46-,53-48-,54-49-,54-51-,55-50-,56-55- |
| InChIKey | JXOXLATVKSVLAK-AFQVUMPUSA-N |
| XLogP | 15.80 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.20 |
| LogP ≤ 5 | 15.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |