C61H64N4 — CID 118491319
5,10,15,20-tetrakis(4-tert-butylphenyl)-23-methyl-21H-porphyrin (PubChem CID 118491319) has the molecular formula C61H64N4 and a molecular weight of 853.21 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(4-tert-butylphenyl)-23-methyl-21H-porphyrin.
| Compound Name | 5,10,15,20-tetrakis(4-tert-butylphenyl)-23-methyl-21H-porphyrin |
|---|---|
| PubChem CID | 118491319 |
| Molecular Formula | C61H64N4 |
| Molecular Weight | 853.21 g/mol |
| Exact Mass | 852.51 |
| IUPAC Name | 5,10,15,20-tetrakis(4-tert-butylphenyl)-23-methyl-21H-porphyrin |
| SMILES | Cn1c2ccc1c(-c1ccc(C(C)(C)C)cc1)c1nc(c(-c3ccc(C(C)(C)C)cc3)c3ccc([nH]3)c(-c3ccc(C(C)(C)C)cc3)c3nc(c2-c2ccc(C(C)(C)C)cc2)C=C3)C=C1 |
| InChI | InChI=1S/C61H64N4/c1-58(2,3)42-22-14-38(15-23-42)54-46-30-31-47(62-46)55(39-16-24-43(25-17-39)59(4,5)6)49-33-35-51(64-49)57(41-20-28-45(29-21-41)61(10,11)12)53-37-36-52(65(53)13)56(50-34-32-48(54)63-50)40-18-26-44(27-19-40)60(7,8)9/h14-37,62H,1-13H3/b54-46-,54-48-,55-47-,55-49-,56-50-,56-52-,57-51-,57-53- |
| InChIKey | XUTYGTSPKDMCGP-NEVWMPLJSA-N |
| XLogP | 16.52 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.21 |
| LogP ≤ 5 | 16.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |