C58H60N6O2 — CID 10952992
1-butyl-6-[10,15,20-tris(4-tert-butylphenyl)-23,24-dihydroporphyrin-5-yl]pyrimidine-2,4-dione (PubChem CID 10952992) has the molecular formula C58H60N6O2 and a molecular weight of 873.16 g/mol. Its IUPAC name is 1-butyl-6-[10,15,20-tris(4-tert-butylphenyl)-23,24-dihydroporphyrin-5-yl]pyrimidine-2,4-dione.
| Compound Name | 1-butyl-6-[10,15,20-tris(4-tert-butylphenyl)-23,24-dihydroporphyrin-5-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10952992 |
| Molecular Formula | C58H60N6O2 |
| Molecular Weight | 873.16 g/mol |
| Exact Mass | 872.48 |
| IUPAC Name | 1-butyl-6-[10,15,20-tris(4-tert-butylphenyl)-23,24-dihydroporphyrin-5-yl]pyrimidine-2,4-dione |
| SMILES | CCCCn1c(-c2c3nc(c(-c4ccc(C(C)(C)C)cc4)c4ccc([nH]4)c(-c4ccc(C(C)(C)C)cc4)c4ccc([nH]4)c(-c4ccc(C(C)(C)C)cc4)c4nc2C=C4)C=C3)cc(=O)[nH]c1=O |
| InChI | InChI=1S/C58H60N6O2/c1-11-12-33-64-49(34-50(65)63-55(64)66)54-47-31-29-45(61-47)52(36-15-21-39(22-16-36)57(5,6)7)43-27-25-41(59-43)51(35-13-19-38(20-14-35)56(2,3)4)42-26-28-44(60-42)53(46-30-32-48(54)62-46)37-17-23-40(24-18-37)58(8,9)10/h13-32,34,59-60H,11-12,33H2,1-10H3,(H,63,65,66)/b51-41-,51-42-,52-43-,52-45-,53-44-,53-46-,54-47+,54-48+ |
| InChIKey | NHBGNCMZDLSPGQ-ZCZFQKPJSA-N |
| XLogP | 13.87 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.16 |
| LogP ≤ 5 | 13.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |