C70H91N4O3P — CID 135407807
5-dibutoxyphosphoryl-10,15,20-tris(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin (PubChem CID 135407807) has the molecular formula C70H91N4O3P and a molecular weight of 1067.50 g/mol. Its IUPAC name is 5-dibutoxyphosphoryl-10,15,20-tris(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5-dibutoxyphosphoryl-10,15,20-tris(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135407807 |
| Molecular Formula | C70H91N4O3P |
| Molecular Weight | 1067.50 g/mol |
| Exact Mass | 1066.68 |
| IUPAC Name | 5-dibutoxyphosphoryl-10,15,20-tris(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin |
| SMILES | CCCCOP(=O)(OCCCC)c1c2nc(c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c3ccc([nH]3)c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c3nc(c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C70H91N4O3P/c1-21-23-33-76-78(75,77-34-24-22-2)64-59-31-29-57(73-59)62(45-37-49(67(9,10)11)42-50(38-45)68(12,13)14)55-27-25-53(71-55)61(44-35-47(65(3,4)5)41-48(36-44)66(6,7)8)54-26-28-56(72-54)63(58-30-32-60(64)74-58)46-39-51(69(15,16)17)43-52(40-46)70(18,19)20/h25-32,35-43,71,74H,21-24,33-34H2,1-20H3/b61-53-,61-54-,62-55-,62-57-,63-56-,63-58-,64-59+,64-60+ |
| InChIKey | JLINKTGVDVQWAA-SYSFONTOSA-N |
| XLogP | 19.89 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1067.50 |
| LogP ≤ 5 | 19.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|