C69H79BrN4 — CID 10235241
15-[4-(bromomethyl)phenyl]-5,10,20-tris(3,5-ditert-butylphenyl)-21,22-dihydroporphyrin (PubChem CID 10235241) has the molecular formula C69H79BrN4 and a molecular weight of 1044.32 g/mol. Its IUPAC name is 15-[4-(bromomethyl)phenyl]-5,10,20-tris(3,5-ditert-butylphenyl)-21,22-dihydroporphyrin.
| Compound Name | 15-[4-(bromomethyl)phenyl]-5,10,20-tris(3,5-ditert-butylphenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10235241 |
| Molecular Formula | C69H79BrN4 |
| Molecular Weight | 1044.32 g/mol |
| Exact Mass | 1042.55 |
| IUPAC Name | 15-[4-(bromomethyl)phenyl]-5,10,20-tris(3,5-ditert-butylphenyl)-21,22-dihydroporphyrin |
| SMILES | CC(C)(C)c1cc(-c2c3nc(c(-c4ccc(CBr)cc4)c4nc(c(-c5cc(C(C)(C)C)cc(C(C)(C)C)c5)c5ccc([nH]5)c(-c5cc(C(C)(C)C)cc(C(C)(C)C)c5)c5ccc2[nH]5)C=C4)C=C3)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C69H79BrN4/c1-64(2,3)46-31-43(32-47(37-46)65(4,5)6)61-54-25-23-52(71-54)60(42-21-19-41(40-70)20-22-42)53-24-26-55(72-53)62(44-33-48(66(7,8)9)38-49(34-44)67(10,11)12)57-28-30-59(74-57)63(58-29-27-56(61)73-58)45-35-50(68(13,14)15)39-51(36-45)69(16,17)18/h19-39,73-74H,40H2,1-18H3/b60-52-,60-53-,61-54-,61-56-,62-55-,62-57-,63-58-,63-59- |
| InChIKey | LOUYQFVXIWGPQV-SWPMMZLJSA-N |
| XLogP | 20.00 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1044.32 |
| LogP ≤ 5 | 20.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|