C60H60I2N4 — CID 135501292
5,20-bis(3,5-ditert-butylphenyl)-10,15-bis(4-iodophenyl)-21,23-dihydroporphyrin (PubChem CID 135501292) has the molecular formula C60H60I2N4 and a molecular weight of 1090.98 g/mol. Its IUPAC name is 5,20-bis(3,5-ditert-butylphenyl)-10,15-bis(4-iodophenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,20-bis(3,5-ditert-butylphenyl)-10,15-bis(4-iodophenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135501292 |
| Molecular Formula | C60H60I2N4 |
| Molecular Weight | 1090.98 g/mol |
| Exact Mass | 1090.29 |
| IUPAC Name | 5,20-bis(3,5-ditert-butylphenyl)-10,15-bis(4-iodophenyl)-21,23-dihydroporphyrin |
| SMILES | CC(C)(C)c1cc(-c2c3nc(c(-c4ccc(I)cc4)c4ccc([nH]4)c(-c4ccc(I)cc4)c4nc(c(-c5cc(C(C)(C)C)cc(C(C)(C)C)c5)c5ccc2[nH]5)C=C4)C=C3)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C60H60I2N4/c1-57(2,3)39-29-37(30-40(33-39)58(4,5)6)55-49-25-23-47(64-49)53(35-13-17-43(61)18-14-35)45-21-22-46(63-45)54(36-15-19-44(62)20-16-36)48-24-26-50(65-48)56(52-28-27-51(55)66-52)38-31-41(59(7,8)9)34-42(32-38)60(10,11)12/h13-34,63,66H,1-12H3/b53-45-,53-47-,54-46-,54-48-,55-49-,55-51-,56-50-,56-52- |
| InChIKey | XKOGVVCGBNFRMY-DQRXBFAESA-N |
| XLogP | 17.72 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1090.98 |
| LogP ≤ 5 | 17.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|