C62H73IN4 — CID 135491289
5,10,15-tris(3,5-ditert-butylphenyl)-20-iodo-21,23-dihydroporphyrin (PubChem CID 135491289) has the molecular formula C62H73IN4 and a molecular weight of 1001.20 g/mol. Its IUPAC name is 5,10,15-tris(3,5-ditert-butylphenyl)-20-iodo-21,23-dihydroporphyrin.
| Compound Name | 5,10,15-tris(3,5-ditert-butylphenyl)-20-iodo-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135491289 |
| Molecular Formula | C62H73IN4 |
| Molecular Weight | 1001.20 g/mol |
| Exact Mass | 1000.49 |
| IUPAC Name | 5,10,15-tris(3,5-ditert-butylphenyl)-20-iodo-21,23-dihydroporphyrin |
| SMILES | CC(C)(C)c1cc(-c2c3nc(c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4ccc([nH]4)c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4nc(c(I)c5ccc2[nH]5)C=C4)C=C3)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C62H73IN4/c1-57(2,3)39-27-36(28-40(33-39)58(4,5)6)53-45-19-21-47(64-45)54(37-29-41(59(7,8)9)34-42(30-37)60(10,11)12)49-23-25-51(66-49)56(63)52-26-24-50(67-52)55(48-22-20-46(53)65-48)38-31-43(61(13,14)15)35-44(32-38)62(16,17)18/h19-35,64,67H,1-18H3/b53-45-,53-46-,54-47-,54-49-,55-48-,55-50-,56-51+,56-52+ |
| InChIKey | IHMMBMCBACTPBZ-VUURASSBSA-N |
| XLogP | 18.05 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1001.20 |
| LogP ≤ 5 | 18.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|