C71H93N4S+ — CID 136835073
methyl-octyl-[10,15,20-tris(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]sulfanium (PubChem CID 136835073) has the molecular formula C71H93N4S+ and a molecular weight of 1034.62 g/mol. Its IUPAC name is methyl-octyl-[10,15,20-tris(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]sulfanium.
| Compound Name | methyl-octyl-[10,15,20-tris(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]sulfanium |
|---|---|
| PubChem CID | 136835073 |
| Molecular Formula | C71H93N4S+ |
| Molecular Weight | 1034.62 g/mol |
| Exact Mass | 1033.71 |
| IUPAC Name | methyl-octyl-[10,15,20-tris(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]sulfanium |
| SMILES | CCCCCCCC[S+](C)c1c2nc(c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c3ccc([nH]3)c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c3nc(c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C71H93N4S/c1-21-22-23-24-25-26-35-76(20)65-60-33-31-58(74-60)63(46-38-50(68(8,9)10)43-51(39-46)69(11,12)13)56-29-27-54(72-56)62(45-36-48(66(2,3)4)42-49(37-45)67(5,6)7)55-28-30-57(73-55)64(59-32-34-61(65)75-59)47-40-52(70(14,15)16)44-53(41-47)71(17,18)19/h27-34,36-44,72,75H,21-26,35H2,1-20H3/q+1/b62-54-,62-55-,63-56-,63-58-,64-57-,64-59-,65-60+,65-61+ |
| InChIKey | ORIWAEASUQANGH-OHUNRZNDSA-N |
| XLogP | 20.41 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1034.62 |
| LogP ≤ 5 | 20.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|