C45H46N4O2 — CID 102435837
2,7,12-tris(4-tert-butylphenyl)-4-nitro-16,17,18-triazatetracyclo[11.2.1.13,6.18,11]octadeca-1,3,5,7,9,11,13(16),14-octaene (PubChem CID 102435837) has the molecular formula C45H46N4O2 and a molecular weight of 674.89 g/mol. Its IUPAC name is 2,7,12-tris(4-tert-butylphenyl)-4-nitro-16,17,18-triazatetracyclo[11.2.1.13,6.18,11]octadeca-1,3,5,7,9,11,13(16),14-octaene.
| Compound Name | 2,7,12-tris(4-tert-butylphenyl)-4-nitro-16,17,18-triazatetracyclo[11.2.1.13,6.18,11]octadeca-1,3,5,7,9,11,13(16),14-octaene |
|---|---|
| PubChem CID | 102435837 |
| Molecular Formula | C45H46N4O2 |
| Molecular Weight | 674.89 g/mol |
| Exact Mass | 674.36 |
| IUPAC Name | 2,7,12-tris(4-tert-butylphenyl)-4-nitro-16,17,18-triazatetracyclo[11.2.1.13,6.18,11]octadeca-1,3,5,7,9,11,13(16),14-octaene |
| SMILES | CC(C)(C)c1ccc(-c2c3nc(c(-c4ccc(C(C)(C)C)cc4)c4[nH]c(cc4[N+](=O)[O-])c(-c4ccc(C(C)(C)C)cc4)c4ccc2[nH]4)C=C3)cc1 |
| InChI | InChI=1S/C45H46N4O2/c1-43(2,3)30-16-10-27(11-17-30)39-33-22-23-35(46-33)40(28-12-18-31(19-13-28)44(4,5)6)37-26-38(49(50)51)42(48-37)41(36-25-24-34(39)47-36)29-14-20-32(21-15-29)45(7,8)9/h10-26,46,48H,1-9H3/b39-33+,39-34+,40-35-,40-37-,41-36-,42-41- |
| InChIKey | GNCMAFRWRFRNIP-FOPDTXJQSA-N |
| XLogP | 12.45 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.89 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|