C33H20N6O6 — CID 102079866
2,7,12-tris(4-nitrophenyl)-16,17,18-triazatetracyclo[11.2.1.13,6.18,11]octadeca-1(16),2,4,6,8,10,12,14-octaene (PubChem CID 102079866) has the molecular formula C33H20N6O6 and a molecular weight of 596.56 g/mol. Its IUPAC name is 2,7,12-tris(4-nitrophenyl)-16,17,18-triazatetracyclo[11.2.1.13,6.18,11]octadeca-1(16),2,4,6,8,10,12,14-octaene.
| Compound Name | 2,7,12-tris(4-nitrophenyl)-16,17,18-triazatetracyclo[11.2.1.13,6.18,11]octadeca-1(16),2,4,6,8,10,12,14-octaene |
|---|---|
| PubChem CID | 102079866 |
| Molecular Formula | C33H20N6O6 |
| Molecular Weight | 596.56 g/mol |
| Exact Mass | 596.14 |
| IUPAC Name | 2,7,12-tris(4-nitrophenyl)-16,17,18-triazatetracyclo[11.2.1.13,6.18,11]octadeca-1(16),2,4,6,8,10,12,14-octaene |
| SMILES | O=[N+]([O-])c1ccc(-c2c3nc(c(-c4ccc([N+](=O)[O-])cc4)c4ccc([nH]4)c(-c4ccc([N+](=O)[O-])cc4)c4ccc2[nH]4)C=C3)cc1 |
| InChI | InChI=1S/C33H20N6O6/c40-37(41)22-7-1-19(2-8-22)31-25-13-15-27(34-25)32(20-3-9-23(10-4-20)38(42)43)29-17-18-30(36-29)33(28-16-14-26(31)35-28)21-5-11-24(12-6-21)39(44)45/h1-18,34-35H/b31-25-,31-26+,32-27-,32-29-,33-28+,33-30- |
| InChIKey | QLIJLOMITRBHGR-SSVYZTFUSA-N |
| XLogP | 8.38 |
| TPSA | 173.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.56 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|