C44H25Br4N5O2 — CID 136764923
2,3,12,13-tetrabromo-5-(4-nitrophenyl)-10,15,20-triphenyl-21,23-dihydroporphyrin (PubChem CID 136764923) has the molecular formula C44H25Br4N5O2 and a molecular weight of 975.33 g/mol. Its IUPAC name is 2,3,12,13-tetrabromo-5-(4-nitrophenyl)-10,15,20-triphenyl-21,23-dihydroporphyrin.
| Compound Name | 2,3,12,13-tetrabromo-5-(4-nitrophenyl)-10,15,20-triphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136764923 |
| Molecular Formula | C44H25Br4N5O2 |
| Molecular Weight | 975.33 g/mol |
| Exact Mass | 970.87 |
| IUPAC Name | 2,3,12,13-tetrabromo-5-(4-nitrophenyl)-10,15,20-triphenyl-21,23-dihydroporphyrin |
| SMILES | O=[N+]([O-])c1ccc(-c2c3nc(c(-c4ccccc4)c4[nH]c(c(Br)c4Br)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5[nH]c2c(Br)c5Br)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C44H25Br4N5O2/c45-37-38(46)42-35(26-14-8-3-9-15-26)31-22-23-32(50-31)36(27-16-18-28(19-17-27)53(54)55)44-40(48)39(47)43(52-44)34(25-12-6-2-7-13-25)30-21-20-29(49-30)33(41(37)51-42)24-10-4-1-5-11-24/h1-23,51-52H/b33-29-,34-30-,35-31-,36-32-,41-33-,42-35-,43-34-,44-36- |
| InChIKey | FMZHNRAWAFTQEL-QLCXEPOMSA-N |
| XLogP | 14.28 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 975.33 |
| LogP ≤ 5 | 14.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|