About formaldehyde;bis(1-nitro-4-phenylbenzene)
formaldehyde;bis(1-nitro-4-phenylbenzene) (PubChem CID 174842779) has the molecular formula C25H20N2O5
and a molecular weight of 428.44 g/mol. Its IUPAC name is formaldehyde;bis(1-nitro-4-phenylbenzene).
Molecular Properties
| Compound Name | formaldehyde;bis(1-nitro-4-phenylbenzene) |
| PubChem CID | 174842779 |
| Molecular Formula | C25H20N2O5 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | formaldehyde;bis(1-nitro-4-phenylbenzene) |
| SMILES | C=O.O=[N+]([O-])c1ccc(-c2ccccc2)cc1.O=[N+]([O-])c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/2C12H9NO2.CH2O/c2*14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-2/h2*1-9H;1H2 |
| InChIKey | OCHXODVTZOFKEL-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;bis(1-nitro-4-phenylbenzene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;bis(1-nitro-4-phenylbenzene)?
The IUPAC name of formaldehyde;bis(1-nitro-4-phenylbenzene) (CID 174842779) is formaldehyde;bis(1-nitro-4-phenylbenzene).
What is the SMILES notation for formaldehyde;bis(1-nitro-4-phenylbenzene)?
The canonical SMILES for formaldehyde;bis(1-nitro-4-phenylbenzene) is C=O.O=[N+]([O-])c1ccc(-c2ccccc2)cc1.O=[N+]([O-])c1ccc(-c2ccccc2)cc1.
What is the InChIKey of formaldehyde;bis(1-nitro-4-phenylbenzene)?
The InChIKey is OCHXODVTZOFKEL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H9NO2.CH2O/c2*14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-2/h2*1-9H;1H2.
What are the key properties of formaldehyde;bis(1-nitro-4-phenylbenzene)?
formaldehyde;bis(1-nitro-4-phenylbenzene) has a molecular weight of 428.44 g/mol, XLogP of 6.34, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;bis(1-nitro-4-phenylbenzene) is sourced from PubChem (CID 174842779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).