About bis(1-nitro-4-phenylbenzene);sulfur dioxide
bis(1-nitro-4-phenylbenzene);sulfur dioxide (PubChem CID 174751271) has the molecular formula C24H18N2O6S
and a molecular weight of 462.48 g/mol. Its IUPAC name is bis(1-nitro-4-phenylbenzene);sulfur dioxide.
Molecular Properties
| Compound Name | bis(1-nitro-4-phenylbenzene);sulfur dioxide |
| PubChem CID | 174751271 |
| Molecular Formula | C24H18N2O6S |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | bis(1-nitro-4-phenylbenzene);sulfur dioxide |
| SMILES | O=S=O.O=[N+]([O-])c1ccc(-c2ccccc2)cc1.O=[N+]([O-])c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/2C12H9NO2.O2S/c2*14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-3-2/h2*1-9H; |
| InChIKey | VYYKQIKXBRTVTG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(1-nitro-4-phenylbenzene);sulfur dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-nitro-4-phenylbenzene);sulfur dioxide?
The IUPAC name of bis(1-nitro-4-phenylbenzene);sulfur dioxide (CID 174751271) is bis(1-nitro-4-phenylbenzene);sulfur dioxide.
What is the SMILES notation for bis(1-nitro-4-phenylbenzene);sulfur dioxide?
The canonical SMILES for bis(1-nitro-4-phenylbenzene);sulfur dioxide is O=S=O.O=[N+]([O-])c1ccc(-c2ccccc2)cc1.O=[N+]([O-])c1ccc(-c2ccccc2)cc1.
What is the InChIKey of bis(1-nitro-4-phenylbenzene);sulfur dioxide?
The InChIKey is VYYKQIKXBRTVTG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H9NO2.O2S/c2*14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-3-2/h2*1-9H;.
What are the key properties of bis(1-nitro-4-phenylbenzene);sulfur dioxide?
bis(1-nitro-4-phenylbenzene);sulfur dioxide has a molecular weight of 462.48 g/mol, XLogP of 5.85, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-nitro-4-phenylbenzene);sulfur dioxide is sourced from PubChem (CID 174751271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).