C23H16N2O2 — CID 631783
4-(4-nitrophenyl)-2,6-diphenylpyridine (PubChem CID 631783) has the molecular formula C23H16N2O2 and a molecular weight of 352.39 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-2,6-diphenylpyridine.
| Compound Name | 4-(4-nitrophenyl)-2,6-diphenylpyridine |
|---|---|
| PubChem CID | 631783 |
| Molecular Formula | C23H16N2O2 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 4-(4-nitrophenyl)-2,6-diphenylpyridine |
| SMILES | O=[N+]([O-])c1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C23H16N2O2/c26-25(27)21-13-11-17(12-14-21)20-15-22(18-7-3-1-4-8-18)24-23(16-20)19-9-5-2-6-10-19/h1-16H |
| InChIKey | DUUHRLJSNIXIHI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|