C41H26N4O9 — CID 71623316
2,4,6-tris[4-(4-nitrophenoxy)phenyl]pyridine (PubChem CID 71623316) has the molecular formula C41H26N4O9 and a molecular weight of 718.68 g/mol. Its IUPAC name is 2,4,6-tris[4-(4-nitrophenoxy)phenyl]pyridine.
| Compound Name | 2,4,6-tris[4-(4-nitrophenoxy)phenyl]pyridine |
|---|---|
| PubChem CID | 71623316 |
| Molecular Formula | C41H26N4O9 |
| Molecular Weight | 718.68 g/mol |
| Exact Mass | 718.17 |
| IUPAC Name | 2,4,6-tris[4-(4-nitrophenoxy)phenyl]pyridine |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc(-c3cc(-c4ccc(Oc5ccc([N+](=O)[O-])cc5)cc4)nc(-c4ccc(Oc5ccc([N+](=O)[O-])cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C41H26N4O9/c46-43(47)31-7-19-37(20-8-31)52-34-13-1-27(2-14-34)30-25-40(28-3-15-35(16-4-28)53-38-21-9-32(10-22-38)44(48)49)42-41(26-30)29-5-17-36(18-6-29)54-39-23-11-33(12-24-39)45(50)51/h1-26H |
| InChIKey | RYOFVUZLJIPMCE-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 170.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.68 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|