C15H9ClN4O4 — CID 135632034
6-chloro-4-[4-(4-nitrophenoxy)phenyl]-1H-1,3,5-triazin-2-one (PubChem CID 135632034) has the molecular formula C15H9ClN4O4 and a molecular weight of 344.71 g/mol. Its IUPAC name is 6-chloro-4-[4-(4-nitrophenoxy)phenyl]-1H-1,3,5-triazin-2-one.
| Compound Name | 6-chloro-4-[4-(4-nitrophenoxy)phenyl]-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 135632034 |
| Molecular Formula | C15H9ClN4O4 |
| Molecular Weight | 344.71 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 6-chloro-4-[4-(4-nitrophenoxy)phenyl]-1H-1,3,5-triazin-2-one |
| SMILES | O=c1nc(-c2ccc(Oc3ccc([N+](=O)[O-])cc3)cc2)nc(Cl)[nH]1 |
| InChI | InChI=1S/C15H9ClN4O4/c16-14-17-13(18-15(21)19-14)9-1-5-11(6-2-9)24-12-7-3-10(4-8-12)20(22)23/h1-8H,(H,17,18,19,21) |
| InChIKey | PRAYPANYNDEFEV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.71 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|