C21H12N3O6- — CID 7371151
4-[4-[5-(4-nitrophenyl)-1,2,4-oxadiazol-3-yl]phenoxy]benzoate (PubChem CID 7371151) has the molecular formula C21H12N3O6- and a molecular weight of 402.34 g/mol. Its IUPAC name is 4-[4-[5-(4-nitrophenyl)-1,2,4-oxadiazol-3-yl]phenoxy]benzoate.
| Compound Name | 4-[4-[5-(4-nitrophenyl)-1,2,4-oxadiazol-3-yl]phenoxy]benzoate |
|---|---|
| PubChem CID | 7371151 |
| Molecular Formula | C21H12N3O6- |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 4-[4-[5-(4-nitrophenyl)-1,2,4-oxadiazol-3-yl]phenoxy]benzoate |
| SMILES | O=C([O-])c1ccc(Oc2ccc(-c3noc(-c4ccc([N+](=O)[O-])cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C21H13N3O6/c25-21(26)15-5-11-18(12-6-15)29-17-9-3-13(4-10-17)19-22-20(30-23-19)14-1-7-16(8-2-14)24(27)28/h1-12H,(H,25,26)/p-1 |
| InChIKey | XADWOUUOENUOJD-UHFFFAOYSA-M |
| XLogP | 3.47 |
| TPSA | 131.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|