C22H17N3O5 — CID 19330837
5-[4-[(4-methoxyphenoxy)methyl]phenyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole (PubChem CID 19330837) has the molecular formula C22H17N3O5 and a molecular weight of 403.39 g/mol. Its IUPAC name is 5-[4-[(4-methoxyphenoxy)methyl]phenyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[4-[(4-methoxyphenoxy)methyl]phenyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 19330837 |
| Molecular Formula | C22H17N3O5 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 5-[4-[(4-methoxyphenoxy)methyl]phenyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole |
| SMILES | COc1ccc(OCc2ccc(-c3nc(-c4ccc([N+](=O)[O-])cc4)no3)cc2)cc1 |
| InChI | InChI=1S/C22H17N3O5/c1-28-19-10-12-20(13-11-19)29-14-15-2-4-17(5-3-15)22-23-21(24-30-22)16-6-8-18(9-7-16)25(26)27/h2-13H,14H2,1H3 |
| InChIKey | OVHHYMQHNSLUPI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 100.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|