C15H15NO5 — CID 7707175
1,3-dimethoxy-5-[(4-nitrophenyl)methoxy]benzene (PubChem CID 7707175) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is 1,3-dimethoxy-5-[(4-nitrophenyl)methoxy]benzene.
| Compound Name | 1,3-dimethoxy-5-[(4-nitrophenyl)methoxy]benzene |
|---|---|
| PubChem CID | 7707175 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 1,3-dimethoxy-5-[(4-nitrophenyl)methoxy]benzene |
| SMILES | COc1cc(OC)cc(OCc2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C15H15NO5/c1-19-13-7-14(20-2)9-15(8-13)21-10-11-3-5-12(6-4-11)16(17)18/h3-9H,10H2,1-2H3 |
| InChIKey | CDXPEBOBAXWKLW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|