C23H20N2O9 — CID 162354063
(4-nitrophenyl)methyl 2,4-dimethoxy-6-[(4-nitrophenyl)methoxy]benzoate (PubChem CID 162354063) has the molecular formula C23H20N2O9 and a molecular weight of 468.42 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2,4-dimethoxy-6-[(4-nitrophenyl)methoxy]benzoate.
| Compound Name | (4-nitrophenyl)methyl 2,4-dimethoxy-6-[(4-nitrophenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 162354063 |
| Molecular Formula | C23H20N2O9 |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | (4-nitrophenyl)methyl 2,4-dimethoxy-6-[(4-nitrophenyl)methoxy]benzoate |
| SMILES | COc1cc(OC)c(C(=O)OCc2ccc([N+](=O)[O-])cc2)c(OCc2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C23H20N2O9/c1-31-19-11-20(32-2)22(23(26)34-14-16-5-9-18(10-6-16)25(29)30)21(12-19)33-13-15-3-7-17(8-4-15)24(27)28/h3-12H,13-14H2,1-2H3 |
| InChIKey | YHQYBFUHYMBBLR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 140.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|