About 1-nitro-4-phenylbenzene;sulfurochloridic acid
1-nitro-4-phenylbenzene;sulfurochloridic acid (PubChem CID 23180093) has the molecular formula C12H10ClNO5S
and a molecular weight of 315.73 g/mol. Its IUPAC name is 1-nitro-4-phenylbenzene;sulfurochloridic acid.
Molecular Properties
| Compound Name | 1-nitro-4-phenylbenzene;sulfurochloridic acid |
| PubChem CID | 23180093 |
| Molecular Formula | C12H10ClNO5S |
| Molecular Weight | 315.73 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 1-nitro-4-phenylbenzene;sulfurochloridic acid |
| SMILES | O=S(=O)(O)Cl.O=[N+]([O-])c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H9NO2.ClHO3S/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-5(2,3)4/h1-9H;(H,2,3,4) |
| InChIKey | OAEWLWODRPNHSN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.73 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-nitro-4-phenylbenzene;sulfurochloridic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitro-4-phenylbenzene;sulfurochloridic acid?
The IUPAC name of 1-nitro-4-phenylbenzene;sulfurochloridic acid (CID 23180093) is 1-nitro-4-phenylbenzene;sulfurochloridic acid.
What is the SMILES notation for 1-nitro-4-phenylbenzene;sulfurochloridic acid?
The canonical SMILES for 1-nitro-4-phenylbenzene;sulfurochloridic acid is O=S(=O)(O)Cl.O=[N+]([O-])c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1-nitro-4-phenylbenzene;sulfurochloridic acid?
The InChIKey is OAEWLWODRPNHSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO2.ClHO3S/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-5(2,3)4/h1-9H;(H,2,3,4).
What are the key properties of 1-nitro-4-phenylbenzene;sulfurochloridic acid?
1-nitro-4-phenylbenzene;sulfurochloridic acid has a molecular weight of 315.73 g/mol, XLogP of 3.29, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitro-4-phenylbenzene;sulfurochloridic acid is sourced from PubChem (CID 23180093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).