C44H28N6O10S2 — CID 10328252
4-[10,15-bis(4-nitrophenyl)-20-(4-sulfophenyl)-23,24-dihydroporphyrin-5-yl]benzenesulfonic acid (PubChem CID 10328252) has the molecular formula C44H28N6O10S2 and a molecular weight of 864.87 g/mol. Its IUPAC name is 4-[10,15-bis(4-nitrophenyl)-20-(4-sulfophenyl)-23,24-dihydroporphyrin-5-yl]benzenesulfonic acid.
| Compound Name | 4-[10,15-bis(4-nitrophenyl)-20-(4-sulfophenyl)-23,24-dihydroporphyrin-5-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 10328252 |
| Molecular Formula | C44H28N6O10S2 |
| Molecular Weight | 864.87 g/mol |
| Exact Mass | 864.13 |
| IUPAC Name | 4-[10,15-bis(4-nitrophenyl)-20-(4-sulfophenyl)-23,24-dihydroporphyrin-5-yl]benzenesulfonic acid |
| SMILES | O=[N+]([O-])c1ccc(-c2c3nc(c(-c4ccc(S(=O)(=O)O)cc4)c4nc(c(-c5ccc(S(=O)(=O)O)cc5)c5ccc([nH]5)c(-c5ccc([N+](=O)[O-])cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C44H28N6O10S2/c51-49(52)29-9-1-25(2-10-29)41-33-17-18-34(45-33)42(26-3-11-30(12-4-26)50(53)54)36-20-22-38(47-36)44(28-7-15-32(16-8-28)62(58,59)60)40-24-23-39(48-40)43(37-21-19-35(41)46-37)27-5-13-31(14-6-27)61(55,56)57/h1-24,45-46H,(H,55,56,57)(H,58,59,60)/b41-33-,41-35-,42-34-,42-36-,43-37-,43-39-,44-38-,44-40- |
| InChIKey | WPXCRZLROABASH-JAAFTSFNSA-N |
| XLogP | 9.63 |
| TPSA | 252.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.87 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|