C45H30N4O10S3 — CID 162349982
4-[20-(4-formylphenyl)-10,15-bis(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid (PubChem CID 162349982) has the molecular formula C45H30N4O10S3 and a molecular weight of 882.95 g/mol. Its IUPAC name is 4-[20-(4-formylphenyl)-10,15-bis(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid.
| Compound Name | 4-[20-(4-formylphenyl)-10,15-bis(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 162349982 |
| Molecular Formula | C45H30N4O10S3 |
| Molecular Weight | 882.95 g/mol |
| Exact Mass | 882.11 |
| IUPAC Name | 4-[20-(4-formylphenyl)-10,15-bis(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid |
| SMILES | O=Cc1ccc(-c2c3nc(c(-c4ccc(S(=O)(=O)O)cc4)c4ccc([nH]4)c(-c4ccc(S(=O)(=O)O)cc4)c4nc(c(-c5ccc(S(=O)(=O)O)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C45H30N4O10S3/c50-25-26-1-3-27(4-2-26)42-34-17-19-36(46-34)43(28-5-11-31(12-6-28)60(51,52)53)38-21-23-40(48-38)45(30-9-15-33(16-10-30)62(57,58)59)41-24-22-39(49-41)44(37-20-18-35(42)47-37)29-7-13-32(14-8-29)61(54,55)56/h1-25,46,49H,(H,51,52,53)(H,54,55,56)(H,57,58,59)/b42-34-,42-35-,43-36-,43-38-,44-37-,44-39-,45-40-,45-41- |
| InChIKey | WXBCDQMUQKGILS-HIXPDHBDSA-N |
| XLogP | 8.88 |
| TPSA | 237.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.95 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|