C49H32N4O4 — CID 146390062
4-[15-(4-acetylphenyl)-10,20-bis(4-formylphenyl)-21,23-dihydroporphyrin-5-yl]benzaldehyde (PubChem CID 146390062) has the molecular formula C49H32N4O4 and a molecular weight of 740.82 g/mol. Its IUPAC name is 4-[15-(4-acetylphenyl)-10,20-bis(4-formylphenyl)-21,23-dihydroporphyrin-5-yl]benzaldehyde.
| Compound Name | 4-[15-(4-acetylphenyl)-10,20-bis(4-formylphenyl)-21,23-dihydroporphyrin-5-yl]benzaldehyde |
|---|---|
| PubChem CID | 146390062 |
| Molecular Formula | C49H32N4O4 |
| Molecular Weight | 740.82 g/mol |
| Exact Mass | 740.24 |
| IUPAC Name | 4-[15-(4-acetylphenyl)-10,20-bis(4-formylphenyl)-21,23-dihydroporphyrin-5-yl]benzaldehyde |
| SMILES | CC(=O)c1ccc(-c2c3nc(c(-c4ccc(C=O)cc4)c4ccc([nH]4)c(-c4ccc(C=O)cc4)c4nc(c(-c5ccc(C=O)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C49H32N4O4/c1-29(57)33-14-16-37(17-15-33)49-44-24-22-42(52-44)47(35-10-4-31(27-55)5-11-35)40-20-18-38(50-40)46(34-8-2-30(26-54)3-9-34)39-19-21-41(51-39)48(43-23-25-45(49)53-43)36-12-6-32(28-56)7-13-36/h2-28,50,53H,1H3/b46-38-,46-39-,47-40-,47-42-,48-41-,48-43-,49-44-,49-45- |
| InChIKey | CPEDFBKXBBFGNV-VUXQGAMNSA-N |
| XLogP | 10.96 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.82 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|