C52H34Br4N4O4 — CID 137229236
2-bromo-1-[4-[10,15,20-tris[4-(2-bromoacetyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]ethanone (PubChem CID 137229236) has the molecular formula C52H34Br4N4O4 and a molecular weight of 1098.48 g/mol. Its IUPAC name is 2-bromo-1-[4-[10,15,20-tris[4-(2-bromoacetyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]ethanone.
| Compound Name | 2-bromo-1-[4-[10,15,20-tris[4-(2-bromoacetyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 137229236 |
| Molecular Formula | C52H34Br4N4O4 |
| Molecular Weight | 1098.48 g/mol |
| Exact Mass | 1093.93 |
| IUPAC Name | 2-bromo-1-[4-[10,15,20-tris[4-(2-bromoacetyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]ethanone |
| SMILES | O=C(CBr)c1ccc(-c2c3nc(c(-c4ccc(C(=O)CBr)cc4)c4ccc([nH]4)c(-c4ccc(C(=O)CBr)cc4)c4nc(c(-c5ccc(C(=O)CBr)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C52H34Br4N4O4/c53-25-45(61)29-1-9-33(10-2-29)49-37-17-19-39(57-37)50(34-11-3-30(4-12-34)46(62)26-54)41-21-23-43(59-41)52(36-15-7-32(8-16-36)48(64)28-56)44-24-22-42(60-44)51(40-20-18-38(49)58-40)35-13-5-31(6-14-35)47(63)27-55/h1-24,57,60H,25-28H2/b49-37-,49-38-,50-39-,50-41-,51-40-,51-42-,52-43-,52-44- |
| InChIKey | QRIFETBYUPQHGF-QURNHSOUSA-N |
| XLogP | 13.63 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1098.48 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|