C47H31Cl3N4OS2 — CID 163574925
S-(2-sulfanylethyl) 4-[10,15,20-tris(4-chlorophenyl)-21,23-dihydroporphyrin-5-yl]benzenecarbothioate (PubChem CID 163574925) has the molecular formula C47H31Cl3N4OS2 and a molecular weight of 838.29 g/mol. Its IUPAC name is S-(2-sulfanylethyl) 4-[10,15,20-tris(4-chlorophenyl)-21,23-dihydroporphyrin-5-yl]benzenecarbothioate.
| Compound Name | S-(2-sulfanylethyl) 4-[10,15,20-tris(4-chlorophenyl)-21,23-dihydroporphyrin-5-yl]benzenecarbothioate |
|---|---|
| PubChem CID | 163574925 |
| Molecular Formula | C47H31Cl3N4OS2 |
| Molecular Weight | 838.29 g/mol |
| Exact Mass | 836.10 |
| IUPAC Name | S-(2-sulfanylethyl) 4-[10,15,20-tris(4-chlorophenyl)-21,23-dihydroporphyrin-5-yl]benzenecarbothioate |
| SMILES | O=C(SCCS)c1ccc(-c2c3nc(c(-c4ccc(Cl)cc4)c4ccc([nH]4)c(-c4ccc(Cl)cc4)c4nc(c(-c5ccc(Cl)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C47H31Cl3N4OS2/c48-32-11-5-28(6-12-32)44-37-19-17-35(51-37)43(27-1-3-31(4-2-27)47(55)57-26-25-56)36-18-20-38(52-36)45(29-7-13-33(49)14-8-29)40-22-24-42(54-40)46(41-23-21-39(44)53-41)30-9-15-34(50)16-10-30/h1-24,51,54,56H,25-26H2/b43-35-,43-36-,44-37-,44-39-,45-38-,45-40-,46-41-,46-42- |
| InChIKey | GCQDTIYEGXLAPF-CRLDETFASA-N |
| XLogP | 14.09 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.29 |
| LogP ≤ 5 | 14.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|