C47H37N7O2 — CID 136801785
ethyl 4-[10,15,20-tris(4-aminophenyl)-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 136801785) has the molecular formula C47H37N7O2 and a molecular weight of 731.86 g/mol. Its IUPAC name is ethyl 4-[10,15,20-tris(4-aminophenyl)-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | ethyl 4-[10,15,20-tris(4-aminophenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 136801785 |
| Molecular Formula | C47H37N7O2 |
| Molecular Weight | 731.86 g/mol |
| Exact Mass | 731.30 |
| IUPAC Name | ethyl 4-[10,15,20-tris(4-aminophenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2c3nc(c(-c4ccc(N)cc4)c4ccc([nH]4)c(-c4ccc(N)cc4)c4nc(c(-c5ccc(N)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C47H37N7O2/c1-2-56-47(55)31-5-3-27(4-6-31)43-35-19-21-37(51-35)44(28-7-13-32(48)14-8-28)39-23-25-41(53-39)46(30-11-17-34(50)18-12-30)42-26-24-40(54-42)45(38-22-20-36(43)52-38)29-9-15-33(49)16-10-29/h3-26,51,54H,2,48-50H2,1H3/b43-35-,43-36-,44-37-,44-39-,45-38-,45-40-,46-41-,46-42- |
| InChIKey | KRXOCMKYVTWBLU-CRLDETFASA-N |
| XLogP | 10.25 |
| TPSA | 161.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.86 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|