C33H28N4O6 — CID 137081848
diethyl 10-(4-methoxycarbonylphenyl)-22,23-dihydro-21H-corrin-5,15-dicarboxylate (PubChem CID 137081848) has the molecular formula C33H28N4O6 and a molecular weight of 576.61 g/mol. Its IUPAC name is diethyl 10-(4-methoxycarbonylphenyl)-22,23-dihydro-21H-corrin-5,15-dicarboxylate.
| Compound Name | diethyl 10-(4-methoxycarbonylphenyl)-22,23-dihydro-21H-corrin-5,15-dicarboxylate |
|---|---|
| PubChem CID | 137081848 |
| Molecular Formula | C33H28N4O6 |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | diethyl 10-(4-methoxycarbonylphenyl)-22,23-dihydro-21H-corrin-5,15-dicarboxylate |
| SMILES | CCOC(=O)c1c2nc(c3ccc([nH]3)c(C(=O)OCC)c3ccc([nH]3)c(-c3ccc(C(=O)OC)cc3)c3ccc1[nH]3)C=C2 |
| InChI | InChI=1S/C33H28N4O6/c1-4-42-32(39)29-24-12-10-20(34-24)21-11-13-25(35-21)30(33(40)43-5-2)27-17-15-23(37-27)28(22-14-16-26(29)36-22)18-6-8-19(9-7-18)31(38)41-3/h6-17,34,36-37H,4-5H2,1-3H3/b21-20-,28-22-,28-23-,29-24+,29-26+,30-25+,30-27+ |
| InChIKey | GGHKHQNEUPCXSS-GCMUTNQRSA-N |
| XLogP | 6.50 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|