C40H26N4O4 — CID 177459677
methyl 4-[10,20-diethynyl-15-(4-methoxycarbonylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 177459677) has the molecular formula C40H26N4O4 and a molecular weight of 626.67 g/mol. Its IUPAC name is methyl 4-[10,20-diethynyl-15-(4-methoxycarbonylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | methyl 4-[10,20-diethynyl-15-(4-methoxycarbonylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 177459677 |
| Molecular Formula | C40H26N4O4 |
| Molecular Weight | 626.67 g/mol |
| Exact Mass | 626.20 |
| IUPAC Name | methyl 4-[10,20-diethynyl-15-(4-methoxycarbonylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | C#Cc1c2nc(c(-c3ccc(C(=O)OC)cc3)c3ccc([nH]3)c(C#C)c3nc(c(-c4ccc(C(=O)OC)cc4)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C40H26N4O4/c1-5-27-29-15-19-33(41-29)37(23-7-11-25(12-8-23)39(45)47-3)35-21-17-31(43-35)28(6-2)32-18-22-36(44-32)38(34-20-16-30(27)42-34)24-9-13-26(14-10-24)40(46)48-4/h1-2,7-22,41,44H,3-4H3/b29-27-,30-27-,31-28-,32-28-,37-33-,37-35-,38-34-,38-36- |
| InChIKey | NDYKIUXIOIFZOW-MLLBBEKDSA-N |
| XLogP | 7.53 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.67 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|