C49H33N9O2 — CID 135545256
methyl 4-[[4-(10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin-5-yl)phenyl]diazenyl]benzoate (PubChem CID 135545256) has the molecular formula C49H33N9O2 and a molecular weight of 779.86 g/mol. Its IUPAC name is methyl 4-[[4-(10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin-5-yl)phenyl]diazenyl]benzoate.
| Compound Name | methyl 4-[[4-(10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin-5-yl)phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 135545256 |
| Molecular Formula | C49H33N9O2 |
| Molecular Weight | 779.86 g/mol |
| Exact Mass | 779.28 |
| IUPAC Name | methyl 4-[[4-(10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin-5-yl)phenyl]diazenyl]benzoate |
| SMILES | COC(=O)c1ccc(/N=N/c2ccc(-c3c4nc(c(-c5ccncc5)c5ccc([nH]5)c(-c5ccncc5)c5nc(c(-c6ccncc6)c6ccc3[nH]6)C=C5)C=C4)cc2)cc1 |
| InChI | InChI=1S/C49H33N9O2/c1-60-49(59)34-4-8-36(9-5-34)58-57-35-6-2-30(3-7-35)45-37-10-12-39(53-37)46(31-18-24-50-25-19-31)41-14-16-43(55-41)48(33-22-28-52-29-23-33)44-17-15-42(56-44)47(32-20-26-51-27-21-32)40-13-11-38(45)54-40/h2-29,53,56H,1H3/b45-37-,45-38-,46-39-,46-41-,47-40-,47-42-,48-43-,48-44-,58-57+ |
| InChIKey | PGLHRWNKIKDWFY-KNKFPQIXSA-N |
| XLogP | 11.71 |
| TPSA | 147.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.86 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|