C34H21Br2N5O4 — CID 135445297
methyl 4-[10,20-dibromo-15-(4-nitrophenyl)-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 135445297) has the molecular formula C34H21Br2N5O4 and a molecular weight of 723.38 g/mol. Its IUPAC name is methyl 4-[10,20-dibromo-15-(4-nitrophenyl)-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | methyl 4-[10,20-dibromo-15-(4-nitrophenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 135445297 |
| Molecular Formula | C34H21Br2N5O4 |
| Molecular Weight | 723.38 g/mol |
| Exact Mass | 721.00 |
| IUPAC Name | methyl 4-[10,20-dibromo-15-(4-nitrophenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c3nc(c(Br)c4ccc([nH]4)c(-c4ccc([N+](=O)[O-])cc4)c4nc(c(Br)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C34H21Br2N5O4/c1-45-34(42)20-4-2-18(3-5-20)30-22-10-14-26(37-22)32(35)28-16-12-24(39-28)31(19-6-8-21(9-7-19)41(43)44)25-13-17-29(40-25)33(36)27-15-11-23(30)38-27/h2-17,37,40H,1H3/b30-22-,30-23-,31-24-,31-25-,32-26+,32-28+,33-27+,33-29+ |
| InChIKey | LZGYCIFXXOIHOU-XOLXSKNWSA-N |
| XLogP | 9.21 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.38 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|