C44H32Cl2N8O4 — CID 135474876
5,20-bis(1-methylpyridin-1-ium-4-yl)-10,15-bis(4-nitrophenyl)-21,23-dihydroporphyrin dichloride (PubChem CID 135474876) has the molecular formula C44H32Cl2N8O4 and a molecular weight of 807.70 g/mol. Its IUPAC name is 5,20-bis(1-methylpyridin-1-ium-4-yl)-10,15-bis(4-nitrophenyl)-21,23-dihydroporphyrin dichloride.
| Compound Name | 5,20-bis(1-methylpyridin-1-ium-4-yl)-10,15-bis(4-nitrophenyl)-21,23-dihydroporphyrin dichloride |
|---|---|
| PubChem CID | 135474876 |
| Molecular Formula | C44H32Cl2N8O4 |
| Molecular Weight | 807.70 g/mol |
| Exact Mass | 806.19 |
| IUPAC Name | 5,20-bis(1-methylpyridin-1-ium-4-yl)-10,15-bis(4-nitrophenyl)-21,23-dihydroporphyrin dichloride |
| SMILES | C[n+]1ccc(-c2c3nc(c(-c4ccc([N+](=O)[O-])cc4)c4ccc([nH]4)c(-c4ccc([N+](=O)[O-])cc4)c4nc(c(-c5cc[n+](C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C44H31N8O4.2ClH/c1-49-23-19-29(20-24-49)43-37-15-13-35(46-37)41(27-3-7-31(8-4-27)51(53)54)33-11-12-34(45-33)42(28-5-9-32(10-6-28)52(55)56)36-14-16-38(47-36)44(40-18-17-39(43)48-40)30-21-25-50(2)26-22-30;;/h3-26H,1-2H3,(H,45,46,47,48);2*1H/q+1;;/p-1/b41-33-,41-35-,42-34-,42-36-,43-37-,43-39-,44-38-,44-40-;; |
| InChIKey | YLIUAFSEDBDELX-GIAQKWRESA-M |
| XLogP | 2.80 |
| TPSA | 151.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.70 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|