C44H35N8O2+3 — CID 11967237
10,15,20-tris(1-methylpyridin-1-ium-4-yl)-5-(3-nitrophenyl)-21,22-dihydroporphyrin (PubChem CID 11967237) has the molecular formula C44H35N8O2+3 and a molecular weight of 707.82 g/mol. Its IUPAC name is 10,15,20-tris(1-methylpyridin-1-ium-4-yl)-5-(3-nitrophenyl)-21,22-dihydroporphyrin.
| Compound Name | 10,15,20-tris(1-methylpyridin-1-ium-4-yl)-5-(3-nitrophenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 11967237 |
| Molecular Formula | C44H35N8O2+3 |
| Molecular Weight | 707.82 g/mol |
| Exact Mass | 707.29 |
| IUPAC Name | 10,15,20-tris(1-methylpyridin-1-ium-4-yl)-5-(3-nitrophenyl)-21,22-dihydroporphyrin |
| SMILES | C[n+]1ccc(-c2c3nc(c(-c4cc[n+](C)cc4)c4ccc([nH]4)c(-c4cccc([N+](=O)[O-])c4)c4ccc([nH]4)c(-c4cc[n+](C)cc4)c4nc2C=C4)C=C3)cc1 |
| InChI | InChI=1S/C44H34N8O2/c1-49-21-15-28(16-22-49)41-33-7-9-35(45-33)42(29-17-23-50(2)24-18-29)37-11-13-39(47-37)44(31-5-4-6-32(27-31)52(53)54)40-14-12-38(48-40)43(36-10-8-34(41)46-36)30-19-25-51(3)26-20-30/h4-27H,1-3H3,(H,45,46,47,48)/q+2/p+1/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40- |
| InChIKey | GVHDARWHDKAEGH-LWQDQPMZSA-O |
| XLogP | 7.71 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.82 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|