C44H23Cl6N5O2 — CID 141330427
5,10,15-tris(2,6-dichlorophenyl)-20-(4-nitrophenyl)-21,23-dihydroporphyrin (PubChem CID 141330427) has the molecular formula C44H23Cl6N5O2 and a molecular weight of 866.42 g/mol. Its IUPAC name is 5,10,15-tris(2,6-dichlorophenyl)-20-(4-nitrophenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15-tris(2,6-dichlorophenyl)-20-(4-nitrophenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 141330427 |
| Molecular Formula | C44H23Cl6N5O2 |
| Molecular Weight | 866.42 g/mol |
| Exact Mass | 863.00 |
| IUPAC Name | 5,10,15-tris(2,6-dichlorophenyl)-20-(4-nitrophenyl)-21,23-dihydroporphyrin |
| SMILES | O=[N+]([O-])c1ccc(-c2c3nc(c(-c4c(Cl)cccc4Cl)c4ccc([nH]4)c(-c4c(Cl)cccc4Cl)c4nc(c(-c5c(Cl)cccc5Cl)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C44H23Cl6N5O2/c45-24-4-1-5-25(46)39(24)42-32-16-14-30(51-32)38(22-10-12-23(13-11-22)55(56)57)31-15-17-33(52-31)43(40-26(47)6-2-7-27(40)48)35-19-21-37(54-35)44(36-20-18-34(42)53-36)41-28(49)8-3-9-29(41)50/h1-21,51,54H/b38-30-,38-31-,42-32+,42-34+,43-33+,43-35+,44-36+,44-37+ |
| InChIKey | SYKUTCKBZXMGGA-BEJVYYKOSA-N |
| XLogP | 15.15 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.42 |
| LogP ≤ 5 | 15.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|