C44H23Cl7N4O2S — CID 135749835
4-[10,15,20-tris(2,6-dichlorophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonyl chloride (PubChem CID 135749835) has the molecular formula C44H23Cl7N4O2S and a molecular weight of 919.93 g/mol. Its IUPAC name is 4-[10,15,20-tris(2,6-dichlorophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonyl chloride.
| Compound Name | 4-[10,15,20-tris(2,6-dichlorophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 135749835 |
| Molecular Formula | C44H23Cl7N4O2S |
| Molecular Weight | 919.93 g/mol |
| Exact Mass | 915.94 |
| IUPAC Name | 4-[10,15,20-tris(2,6-dichlorophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc(-c2c3nc(c(-c4c(Cl)cccc4Cl)c4ccc([nH]4)c(-c4c(Cl)cccc4Cl)c4nc(c(-c5c(Cl)cccc5Cl)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C44H23Cl7N4O2S/c45-24-4-1-5-25(46)39(24)42-32-16-14-30(52-32)38(22-10-12-23(13-11-22)58(51,56)57)31-15-17-33(53-31)43(40-26(47)6-2-7-27(40)48)35-19-21-37(55-35)44(36-20-18-34(42)54-36)41-28(49)8-3-9-29(41)50/h1-21,52,55H/b38-30-,38-31-,42-32+,42-34+,43-33+,43-35+,44-36+,44-37+ |
| InChIKey | ZAUIMMNBIRJKCS-BEJVYYKOSA-N |
| XLogP | 15.17 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.93 |
| LogP ≤ 5 | 15.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |