C68H46N4O12S4 — CID 177413209
4-[4-[10,15,20-tris[4-(4-sulfophenyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]benzenesulfonic acid (PubChem CID 177413209) has the molecular formula C68H46N4O12S4 and a molecular weight of 1239.40 g/mol. Its IUPAC name is 4-[4-[10,15,20-tris[4-(4-sulfophenyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]benzenesulfonic acid.
| Compound Name | 4-[4-[10,15,20-tris[4-(4-sulfophenyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 177413209 |
| Molecular Formula | C68H46N4O12S4 |
| Molecular Weight | 1239.40 g/mol |
| Exact Mass | 1238.20 |
| IUPAC Name | 4-[4-[10,15,20-tris[4-(4-sulfophenyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(-c2ccc(-c3c4nc(c(-c5ccc(-c6ccc(S(=O)(=O)O)cc6)cc5)c5ccc([nH]5)c(-c5ccc(-c6ccc(S(=O)(=O)O)cc6)cc5)c5nc(c(-c6ccc(-c7ccc(S(=O)(=O)O)cc7)cc6)c6ccc3[nH]6)C=C5)C=C4)cc2)cc1 |
| InChI | InChI=1S/C68H46N4O12S4/c73-85(74,75)53-25-17-45(18-26-53)41-1-9-49(10-2-41)65-57-33-35-59(69-57)66(50-11-3-42(4-12-50)46-19-27-54(28-20-46)86(76,77)78)61-37-39-63(71-61)68(52-15-7-44(8-16-52)48-23-31-56(32-24-48)88(82,83)84)64-40-38-62(72-64)67(60-36-34-58(65)70-60)51-13-5-43(6-14-51)47-21-29-55(30-22-47)87(79,80)81/h1-40,69,72H,(H,73,74,75)(H,76,77,78)(H,79,80,81)(H,82,83,84)/b65-57-,65-58-,66-59-,66-61-,67-60-,67-62-,68-63-,68-64- |
| InChIKey | YVPYRSZCFCZJGM-ZOUHOBQGSA-N |
| XLogP | 14.98 |
| TPSA | 274.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 88 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1239.40 |
| LogP ≤ 5 | 14.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|