C44H30N6O8S2 — CID 10395707
4-[10-(4-aminophenyl)-15-(4-nitrophenyl)-20-(4-sulfophenyl)-23,24-dihydroporphyrin-5-yl]benzenesulfonic acid (PubChem CID 10395707) has the molecular formula C44H30N6O8S2 and a molecular weight of 834.89 g/mol. Its IUPAC name is 4-[10-(4-aminophenyl)-15-(4-nitrophenyl)-20-(4-sulfophenyl)-23,24-dihydroporphyrin-5-yl]benzenesulfonic acid.
| Compound Name | 4-[10-(4-aminophenyl)-15-(4-nitrophenyl)-20-(4-sulfophenyl)-23,24-dihydroporphyrin-5-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 10395707 |
| Molecular Formula | C44H30N6O8S2 |
| Molecular Weight | 834.89 g/mol |
| Exact Mass | 834.16 |
| IUPAC Name | 4-[10-(4-aminophenyl)-15-(4-nitrophenyl)-20-(4-sulfophenyl)-23,24-dihydroporphyrin-5-yl]benzenesulfonic acid |
| SMILES | Nc1ccc(-c2c3nc(c(-c4ccc(S(=O)(=O)O)cc4)c4nc(c(-c5ccc(S(=O)(=O)O)cc5)c5ccc([nH]5)c(-c5ccc([N+](=O)[O-])cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C44H30N6O8S2/c45-29-9-1-25(2-10-29)41-33-17-19-35(46-33)42(26-3-11-30(12-4-26)50(51)52)36-20-22-38(48-36)44(28-7-15-32(16-8-28)60(56,57)58)40-24-23-39(49-40)43(37-21-18-34(41)47-37)27-5-13-31(14-6-27)59(53,54)55/h1-24,46,48H,45H2,(H,53,54,55)(H,56,57,58)/b41-33-,41-34-,42-35-,42-36-,43-37-,43-39-,44-38-,44-40- |
| InChIKey | XFNWMHMBZHLEPI-VRDUDMDPSA-N |
| XLogP | 9.31 |
| TPSA | 235.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.89 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|