C32H22N4O8S2 — CID 136917778
4-[10,20-dihydroxy-15-(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid (PubChem CID 136917778) has the molecular formula C32H22N4O8S2 and a molecular weight of 654.68 g/mol. Its IUPAC name is 4-[10,20-dihydroxy-15-(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid.
| Compound Name | 4-[10,20-dihydroxy-15-(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 136917778 |
| Molecular Formula | C32H22N4O8S2 |
| Molecular Weight | 654.68 g/mol |
| Exact Mass | 654.09 |
| IUPAC Name | 4-[10,20-dihydroxy-15-(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(-c2c3nc(c(O)c4ccc([nH]4)c(-c4ccc(S(=O)(=O)O)cc4)c4nc(c(O)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C32H22N4O8S2/c37-31-25-13-9-21(33-25)29(17-1-5-19(6-2-17)45(39,40)41)22-10-14-26(34-22)32(38)28-16-12-24(36-28)30(23-11-15-27(31)35-23)18-3-7-20(8-4-18)46(42,43)44/h1-16,33,36-38H,(H,39,40,41)(H,42,43,44)/b29-21-,29-22-,30-23-,30-24-,31-25+,31-27+,32-26+,32-28+ |
| InChIKey | ZCOFQVIMKRAGCG-IBRKNYKGSA-N |
| XLogP | 5.89 |
| TPSA | 206.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.68 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|