C42H28N6O6S2 — CID 135474866
4-[10,15-dipyridin-4-yl-20-(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid (PubChem CID 135474866) has the molecular formula C42H28N6O6S2 and a molecular weight of 776.86 g/mol. Its IUPAC name is 4-[10,15-dipyridin-4-yl-20-(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid.
| Compound Name | 4-[10,15-dipyridin-4-yl-20-(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135474866 |
| Molecular Formula | C42H28N6O6S2 |
| Molecular Weight | 776.86 g/mol |
| Exact Mass | 776.15 |
| IUPAC Name | 4-[10,15-dipyridin-4-yl-20-(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(-c2c3nc(c(-c4ccncc4)c4ccc([nH]4)c(-c4ccncc4)c4nc(c(-c5ccc(S(=O)(=O)O)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C42H28N6O6S2/c49-55(50,51)29-5-1-25(2-6-29)39-31-9-10-32(45-31)40(26-3-7-30(8-4-26)56(52,53)54)34-12-14-36(47-34)42(28-19-23-44-24-20-28)38-16-15-37(48-38)41(27-17-21-43-22-18-27)35-13-11-33(39)46-35/h1-24,45,48H,(H,49,50,51)(H,52,53,54)/b39-31-,39-33-,40-32-,40-34-,41-35-,41-37-,42-36-,42-38- |
| InChIKey | LFUOGXWAJDKHSR-XGGOTWSRSA-N |
| XLogP | 8.61 |
| TPSA | 191.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.86 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|