C45H29N5O9S4 — CID 170783606
4-[20-(4-isothiocyanatophenyl)-10,15-bis(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid (PubChem CID 170783606) has the molecular formula C45H29N5O9S4 and a molecular weight of 912.02 g/mol. Its IUPAC name is 4-[20-(4-isothiocyanatophenyl)-10,15-bis(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid.
| Compound Name | 4-[20-(4-isothiocyanatophenyl)-10,15-bis(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 170783606 |
| Molecular Formula | C45H29N5O9S4 |
| Molecular Weight | 912.02 g/mol |
| Exact Mass | 911.08 |
| IUPAC Name | 4-[20-(4-isothiocyanatophenyl)-10,15-bis(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(-c2c3nc(c(-c4ccc(S(=O)(=O)O)cc4)c4ccc([nH]4)c(-c4ccc(S(=O)(=O)O)cc4)c4nc(c(-c5ccc(N=C=S)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C45H29N5O9S4/c51-61(52,53)31-11-3-27(4-12-31)43-36-19-17-34(47-36)42(26-1-9-30(10-2-26)46-25-60)35-18-20-37(48-35)44(28-5-13-32(14-6-28)62(54,55)56)39-22-24-41(50-39)45(40-23-21-38(43)49-40)29-7-15-33(16-8-29)63(57,58)59/h1-24,47,50H,(H,51,52,53)(H,54,55,56)(H,57,58,59)/b42-34-,42-35-,43-36-,43-38-,44-37-,44-39-,45-40-,45-41- |
| InChIKey | DBFOMBBYEUWMDY-HIXPDHBDSA-N |
| XLogP | 9.80 |
| TPSA | 232.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.02 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|