C44H32N6O6S2 — CID 135488164
4-[10,20-bis(4-aminophenyl)-15-(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid (PubChem CID 135488164) has the molecular formula C44H32N6O6S2 and a molecular weight of 804.91 g/mol. Its IUPAC name is 4-[10,20-bis(4-aminophenyl)-15-(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid.
| Compound Name | 4-[10,20-bis(4-aminophenyl)-15-(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135488164 |
| Molecular Formula | C44H32N6O6S2 |
| Molecular Weight | 804.91 g/mol |
| Exact Mass | 804.18 |
| IUPAC Name | 4-[10,20-bis(4-aminophenyl)-15-(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid |
| SMILES | Nc1ccc(-c2c3nc(c(-c4ccc(S(=O)(=O)O)cc4)c4ccc([nH]4)c(-c4ccc(N)cc4)c4nc(c(-c5ccc(S(=O)(=O)O)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C44H32N6O6S2/c45-29-9-1-25(2-10-29)41-33-17-21-37(47-33)43(27-5-13-31(14-6-27)57(51,52)53)39-23-19-35(49-39)42(26-3-11-30(46)12-4-26)36-20-24-40(50-36)44(38-22-18-34(41)48-38)28-7-15-32(16-8-28)58(54,55)56/h1-24,47,50H,45-46H2,(H,51,52,53)(H,54,55,56)/b41-33-,41-34-,42-35-,42-36-,43-37-,43-39-,44-38-,44-40- |
| InChIKey | QRLATZIWEJRFAE-VRDUDMDPSA-N |
| XLogP | 8.98 |
| TPSA | 218.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.91 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|