About sodium;4-isothiocyanatobenzenesulfonic acid;hydrate
sodium;4-isothiocyanatobenzenesulfonic acid;hydrate (PubChem CID 22715635) has the molecular formula C7H7NNaO4S2+
and a molecular weight of 256.26 g/mol. Its IUPAC name is sodium;4-isothiocyanatobenzenesulfonic acid;hydrate.
Molecular Properties
| Compound Name | sodium;4-isothiocyanatobenzenesulfonic acid;hydrate |
| PubChem CID | 22715635 |
| Molecular Formula | C7H7NNaO4S2+ |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | sodium;4-isothiocyanatobenzenesulfonic acid;hydrate |
| SMILES | O.O=S(=O)(O)c1ccc(N=C=S)cc1.[Na+] |
| InChI | InChI=1S/C7H5NO3S2.Na.H2O/c9-13(10,11)7-3-1-6(2-4-7)8-5-12;;/h1-4H,(H,9,10,11);;1H2/q;+1; |
| InChIKey | TYLQYONISARSPL-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;4-isothiocyanatobenzenesulfonic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;4-isothiocyanatobenzenesulfonic acid;hydrate?
The IUPAC name of sodium;4-isothiocyanatobenzenesulfonic acid;hydrate (CID 22715635) is sodium;4-isothiocyanatobenzenesulfonic acid;hydrate.
What is the SMILES notation for sodium;4-isothiocyanatobenzenesulfonic acid;hydrate?
The canonical SMILES for sodium;4-isothiocyanatobenzenesulfonic acid;hydrate is O.O=S(=O)(O)c1ccc(N=C=S)cc1.[Na+].
What is the InChIKey of sodium;4-isothiocyanatobenzenesulfonic acid;hydrate?
The InChIKey is TYLQYONISARSPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3S2.Na.H2O/c9-13(10,11)7-3-1-6(2-4-7)8-5-12;;/h1-4H,(H,9,10,11);;1H2/q;+1;.
What are the key properties of sodium;4-isothiocyanatobenzenesulfonic acid;hydrate?
sodium;4-isothiocyanatobenzenesulfonic acid;hydrate has a molecular weight of 256.26 g/mol, XLogP of -2.15, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;4-isothiocyanatobenzenesulfonic acid;hydrate is sourced from PubChem (CID 22715635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).