C13H11N3O4S3 — CID 86053947
4-[(4-isothiocyanatophenyl)sulfonylamino]benzenesulfonamide (PubChem CID 86053947) has the molecular formula C13H11N3O4S3 and a molecular weight of 369.45 g/mol. Its IUPAC name is 4-[(4-isothiocyanatophenyl)sulfonylamino]benzenesulfonamide.
| Compound Name | 4-[(4-isothiocyanatophenyl)sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 86053947 |
| Molecular Formula | C13H11N3O4S3 |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | 4-[(4-isothiocyanatophenyl)sulfonylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(N=C=S)cc2)cc1 |
| InChI | InChI=1S/C13H11N3O4S3/c14-22(17,18)12-5-3-11(4-6-12)16-23(19,20)13-7-1-10(2-8-13)15-9-21/h1-8,16H,(H2,14,17,18) |
| InChIKey | BUMICLPBHKHYRK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|