C16H20N2O4S2 — CID 2524649
4-[(2S)-butan-2-yl]-N-(4-sulfamoylphenyl)benzenesulfonamide (PubChem CID 2524649) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 4-[(2S)-butan-2-yl]-N-(4-sulfamoylphenyl)benzenesulfonamide.
| Compound Name | 4-[(2S)-butan-2-yl]-N-(4-sulfamoylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2524649 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 4-[(2S)-butan-2-yl]-N-(4-sulfamoylphenyl)benzenesulfonamide |
| SMILES | CC[C@H](C)c1ccc(S(=O)(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C16H20N2O4S2/c1-3-12(2)13-4-8-16(9-5-13)24(21,22)18-14-6-10-15(11-7-14)23(17,19)20/h4-12,18H,3H2,1-2H3,(H2,17,19,20)/t12-/m0/s1 |
| InChIKey | OONUVBMIHHDTGU-LBPRGKRZSA-N |
| XLogP | 2.65 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |