C16H17Cl2NO2S — CID 22773538
4-butan-2-yl-N-(3,5-dichlorophenyl)benzenesulfonamide (PubChem CID 22773538) has the molecular formula C16H17Cl2NO2S and a molecular weight of 358.29 g/mol. Its IUPAC name is 4-butan-2-yl-N-(3,5-dichlorophenyl)benzenesulfonamide.
| Compound Name | 4-butan-2-yl-N-(3,5-dichlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22773538 |
| Molecular Formula | C16H17Cl2NO2S |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 4-butan-2-yl-N-(3,5-dichlorophenyl)benzenesulfonamide |
| SMILES | CCC(C)c1ccc(S(=O)(=O)Nc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C16H17Cl2NO2S/c1-3-11(2)12-4-6-16(7-5-12)22(20,21)19-15-9-13(17)8-14(18)10-15/h4-11,19H,3H2,1-2H3 |
| InChIKey | VDKRWWYPMFLPIM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |