C12H12ClN3O4S2 — CID 18758681
4-amino-3-chloro-N-(4-sulfamoylphenyl)benzenesulfonamide (PubChem CID 18758681) has the molecular formula C12H12ClN3O4S2 and a molecular weight of 361.83 g/mol. Its IUPAC name is 4-amino-3-chloro-N-(4-sulfamoylphenyl)benzenesulfonamide.
| Compound Name | 4-amino-3-chloro-N-(4-sulfamoylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 18758681 |
| Molecular Formula | C12H12ClN3O4S2 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | 4-amino-3-chloro-N-(4-sulfamoylphenyl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1Cl |
| InChI | InChI=1S/C12H12ClN3O4S2/c13-11-7-10(5-6-12(11)14)22(19,20)16-8-1-3-9(4-2-8)21(15,17)18/h1-7,16H,14H2,(H2,15,17,18) |
| InChIKey | RBUAGOAZCLYMDO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|